C29H41NO4Si — CID 135026916
tert-butyl N-[(2S,3R,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methylhept-5-yn-2-yl]carbamate (PubChem CID 135026916) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methylhept-5-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methylhept-5-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 135026916 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | tert-butyl N-[(2S,3R,4R)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methylhept-5-yn-2-yl]carbamate |
| SMILES | CC#C[C@@H](C)[C@@H](O)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41NO4Si/c1-9-16-22(2)26(31)25(30-27(32)34-28(3,4)5)21-33-35(29(6,7)8,23-17-12-10-13-18-23)24-19-14-11-15-20-24/h10-15,17-20,22,25-26,31H,21H2,1-8H3,(H,30,32)/t22-,25+,26-/m1/s1 |
| InChIKey | OOUGNYGCVZEXSP-ZSQFBXSQSA-N |
| XLogP | 4.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|