C4H2N8O9S — CID 135027379
(NE)-N-[(3aS,6aR)-3,4,6-trinitro-5-oxo-3a,6a-dihydroimidazo[4,5-d][1,3]thiazol-2-ylidene]nitramide (PubChem CID 135027379) has the molecular formula C4H2N8O9S and a molecular weight of 338.17 g/mol. Its IUPAC name is (NE)-N-[(3aS,6aR)-3,4,6-trinitro-5-oxo-3a,6a-dihydroimidazo[4,5-d][1,3]thiazol-2-ylidene]nitramide.
| Compound Name | (NE)-N-[(3aS,6aR)-3,4,6-trinitro-5-oxo-3a,6a-dihydroimidazo[4,5-d][1,3]thiazol-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135027379 |
| Molecular Formula | C4H2N8O9S |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | (NE)-N-[(3aS,6aR)-3,4,6-trinitro-5-oxo-3a,6a-dihydroimidazo[4,5-d][1,3]thiazol-2-ylidene]nitramide |
| SMILES | O=C1N([N+](=O)[O-])[C@@H]2S/C(=N/[N+](=O)[O-])N([N+](=O)[O-])[C@@H]2N1[N+](=O)[O-] |
| InChI | InChI=1S/C4H2N8O9S/c13-4-7(11(18)19)1-2(8(4)12(20)21)22-3(5-9(14)15)6(1)10(16)17/h1-2H/b5-3+/t1-,2-/m1/s1 |
| InChIKey | TWRWJFOMRVSCTO-DNUWJDSDSA-N |
| XLogP | -1.45 |
| TPSA | 211.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|