C20H24N3O — CID 135027532
CID 135027532 (PubChem CID 135027532) has the molecular formula C20H24N3O and a molecular weight of 322.43 g/mol.
| Compound Name | CID 135027532 |
|---|---|
| PubChem CID | 135027532 |
| Molecular Formula | C20H24N3O |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | — |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H]([NH])c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H24N3O/c1-3-13-12-23-9-7-14(13)10-19(23)20(21)16-6-8-22-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-21H,1,7,9-10,12H2,2H3/t13?,14?,19-,20-/m0/s1 |
| InChIKey | HDQDUIZZNZRWFX-CLONCEMUSA-N |
| XLogP | 3.46 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|