About 6,6'-dibromo-2,2'-spirobi[chromene]
6,6'-dibromo-2,2'-spirobi[chromene] (PubChem CID 135027616) has the molecular formula C17H10Br2O2
and a molecular weight of 406.07 g/mol. Its IUPAC name is 6,6'-dibromo-2,2'-spirobi[chromene].
Molecular Properties
| Compound Name | 6,6'-dibromo-2,2'-spirobi[chromene] |
| PubChem CID | 135027616 |
| Molecular Formula | C17H10Br2O2 |
| Molecular Weight | 406.07 g/mol |
| Exact Mass | 403.90 |
| IUPAC Name | 6,6'-dibromo-2,2'-spirobi[chromene] |
| SMILES | Brc1ccc2c(c1)C=CC1(C=Cc3cc(Br)ccc3O1)O2 |
| InChI | InChI=1S/C17H10Br2O2/c18-13-1-3-15-11(9-13)5-7-17(20-15)8-6-12-10-14(19)2-4-16(12)21-17/h1-10H |
| InChIKey | RKJJJWACIVKILB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.07 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6'-dibromo-2,2'-spirobi[chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6'-dibromo-2,2'-spirobi[chromene]?
The IUPAC name of 6,6'-dibromo-2,2'-spirobi[chromene] (CID 135027616) is 6,6'-dibromo-2,2'-spirobi[chromene].
What is the SMILES notation for 6,6'-dibromo-2,2'-spirobi[chromene]?
The canonical SMILES for 6,6'-dibromo-2,2'-spirobi[chromene] is Brc1ccc2c(c1)C=CC1(C=Cc3cc(Br)ccc3O1)O2.
What is the InChIKey of 6,6'-dibromo-2,2'-spirobi[chromene]?
The InChIKey is RKJJJWACIVKILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Br2O2/c18-13-1-3-15-11(9-13)5-7-17(20-15)8-6-12-10-14(19)2-4-16(12)21-17/h1-10H.
What are the key properties of 6,6'-dibromo-2,2'-spirobi[chromene]?
6,6'-dibromo-2,2'-spirobi[chromene] has a molecular weight of 406.07 g/mol, XLogP of 5.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6'-dibromo-2,2'-spirobi[chromene] is sourced from PubChem (CID 135027616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).