C27H51NO6 — CID 135027715
tert-butyl [(E,10R,11R,12S)-11-hydroxy-8,10,13-trimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-8-en-7-yl] carbonate (PubChem CID 135027715) has the molecular formula C27H51NO6 and a molecular weight of 485.71 g/mol. Its IUPAC name is tert-butyl [(E,10R,11R,12S)-11-hydroxy-8,10,13-trimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-8-en-7-yl] carbonate.
| Compound Name | tert-butyl [(E,10R,11R,12S)-11-hydroxy-8,10,13-trimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-8-en-7-yl] carbonate |
|---|---|
| PubChem CID | 135027715 |
| Molecular Formula | C27H51NO6 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | tert-butyl [(E,10R,11R,12S)-11-hydroxy-8,10,13-trimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]tetradec-8-en-7-yl] carbonate |
| SMILES | CCCCCCC(OC(=O)OC(C)(C)C)/C(C)=C/[C@@H](C)[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C27H51NO6/c1-12-13-14-15-16-21(32-25(31)34-27(9,10)11)19(4)17-20(5)23(29)22(18(2)3)28-24(30)33-26(6,7)8/h17-18,20-23,29H,12-16H2,1-11H3,(H,28,30)/b19-17+/t20-,21?,22+,23-/m1/s1 |
| InChIKey | MPZVSNRRLVQSLL-IGXHPSMPSA-N |
| XLogP | 6.77 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|