C9H14O5 — CID 135027779
methyl (5R,7S,7aS)-7-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 135027779) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is methyl (5R,7S,7aS)-7-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (5R,7S,7aS)-7-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 135027779 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | methyl (5R,7S,7aS)-7-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@H]1CC2OCO[C@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C9H14O5/c1-12-9(11)5-2-6(10)8-7(3-5)13-4-14-8/h5-8,10H,2-4H2,1H3/t5-,6+,7?,8+/m1/s1 |
| InChIKey | YFAUJCMRKIMMEJ-CLTDUVIFSA-N |
| XLogP | -0.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |