About 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde (PubChem CID 135028013) has the molecular formula C18H22O5
and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde |
| PubChem CID | 135028013 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde |
| SMILES | CCOC1=CC(=O)[C@](CC=O)(c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H22O5/c1-4-23-14-7-8-18(9-10-19,17(20)12-14)13-5-6-15(21-2)16(11-13)22-3/h5-6,10-12H,4,7-9H2,1-3H3/t18-/m1/s1 |
| InChIKey | XPVSONSEHJIFID-GOSISDBHSA-N |
| XLogP | 2.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde?
The IUPAC name of 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde (CID 135028013) is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde.
What is the SMILES notation for 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde?
The canonical SMILES for 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde is CCOC1=CC(=O)[C@](CC=O)(c2ccc(OC)c(OC)c2)CC1.
What is the InChIKey of 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde?
The InChIKey is XPVSONSEHJIFID-GOSISDBHSA-N. The full InChI is InChI=1S/C18H22O5/c1-4-23-14-7-8-18(9-10-19,17(20)12-14)13-5-6-15(21-2)16(11-13)22-3/h5-6,10-12H,4,7-9H2,1-3H3/t18-/m1/s1.
What are the key properties of 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde?
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde has a molecular weight of 318.37 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-ethoxy-2-oxocyclohex-3-en-1-yl]acetaldehyde is sourced from PubChem (CID 135028013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).