About 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde
2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde (PubChem CID 135028296) has the molecular formula C25H21N3O2
and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde.
Molecular Properties
| Compound Name | 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde |
| PubChem CID | 135028296 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1ccccc1OCc1cn(C(/C=C/c2ccccc2)c2ccccc2)nn1 |
| InChI | InChI=1S/C25H21N3O2/c29-18-22-13-7-8-14-25(22)30-19-23-17-28(27-26-23)24(21-11-5-2-6-12-21)16-15-20-9-3-1-4-10-20/h1-18,24H,19H2/b16-15+ |
| InChIKey | CWWADAHBBFWONP-FOCLMDBBSA-N |
| XLogP | 4.97 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde?
The IUPAC name of 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde (CID 135028296) is 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde.
What is the SMILES notation for 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde?
The canonical SMILES for 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde is O=Cc1ccccc1OCc1cn(C(/C=C/c2ccccc2)c2ccccc2)nn1.
What is the InChIKey of 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde?
The InChIKey is CWWADAHBBFWONP-FOCLMDBBSA-N. The full InChI is InChI=1S/C25H21N3O2/c29-18-22-13-7-8-14-25(22)30-19-23-17-28(27-26-23)24(21-11-5-2-6-12-21)16-15-20-9-3-1-4-10-20/h1-18,24H,19H2/b16-15+.
What are the key properties of 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde?
2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde has a molecular weight of 395.46 g/mol, XLogP of 4.97, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-[(E)-1,3-diphenylprop-2-enyl]triazol-4-yl]methoxy]benzaldehyde is sourced from PubChem (CID 135028296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).