C12H18F3NO — CID 135028319
1,3-dimethyl-3-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one (PubChem CID 135028319) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is 1,3-dimethyl-3-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one.
| Compound Name | 1,3-dimethyl-3-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one |
|---|---|
| PubChem CID | 135028319 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1,3-dimethyl-3-(2,2,2-trifluoroethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one |
| SMILES | CN1C(=O)C(C)(CC(F)(F)F)C2CCCCC21 |
| InChI | InChI=1S/C12H18F3NO/c1-11(7-12(13,14)15)8-5-3-4-6-9(8)16(2)10(11)17/h8-9H,3-7H2,1-2H3 |
| InChIKey | MJHMFYALPVWTMN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |