About N-tert-butyl-N',N'-diethylmethanediamine;chlorogold
N-tert-butyl-N',N'-diethylmethanediamine;chlorogold (PubChem CID 135028320) has the molecular formula C9H21AuClN2-
and a molecular weight of 389.70 g/mol. Its IUPAC name is N-tert-butyl-N',N'-diethylmethanediamine;chlorogold.
Molecular Properties
| Compound Name | N-tert-butyl-N',N'-diethylmethanediamine;chlorogold |
| PubChem CID | 135028320 |
| Molecular Formula | C9H21AuClN2- |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-tert-butyl-N',N'-diethylmethanediamine;chlorogold |
| SMILES | CCN([CH-]NC(C)(C)C)CC.Cl[Au] |
| InChI | InChI=1S/C9H21N2.Au.ClH/c1-6-11(7-2)8-10-9(3,4)5;;/h8,10H,6-7H2,1-5H3;;1H/q-1;+1;/p-1 |
| InChIKey | LBWLCGAQUNZOKZ-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N',N'-diethylmethanediamine;chlorogold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N',N'-diethylmethanediamine;chlorogold?
The IUPAC name of N-tert-butyl-N',N'-diethylmethanediamine;chlorogold (CID 135028320) is N-tert-butyl-N',N'-diethylmethanediamine;chlorogold.
What is the SMILES notation for N-tert-butyl-N',N'-diethylmethanediamine;chlorogold?
The canonical SMILES for N-tert-butyl-N',N'-diethylmethanediamine;chlorogold is CCN([CH-]NC(C)(C)C)CC.Cl[Au].
What is the InChIKey of N-tert-butyl-N',N'-diethylmethanediamine;chlorogold?
The InChIKey is LBWLCGAQUNZOKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H21N2.Au.ClH/c1-6-11(7-2)8-10-9(3,4)5;;/h8,10H,6-7H2,1-5H3;;1H/q-1;+1;/p-1.
What are the key properties of N-tert-butyl-N',N'-diethylmethanediamine;chlorogold?
N-tert-butyl-N',N'-diethylmethanediamine;chlorogold has a molecular weight of 389.70 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N',N'-diethylmethanediamine;chlorogold is sourced from PubChem (CID 135028320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).