C21H27NO5 — CID 135028321
(4S)-4-benzyl-3-[(2S)-2-[(1S,3R,4R)-1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl]propanoyl]-1,3-oxazolidin-2-one (PubChem CID 135028321) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-2-[(1S,3R,4R)-1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl]propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-2-[(1S,3R,4R)-1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl]propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135028321 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-2-[(1S,3R,4R)-1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl]propanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@@H]1O[C@@]2(C)CCC(O2)[C@H]1C |
| InChI | InChI=1S/C21H27NO5/c1-13-17-9-10-21(3,26-17)27-18(13)14(2)19(23)22-16(12-25-20(22)24)11-15-7-5-4-6-8-15/h4-8,13-14,16-18H,9-12H2,1-3H3/t13-,14+,16+,17?,18-,21+/m1/s1 |
| InChIKey | PLZTWCXZPHBNJG-LQHPXLTMSA-N |
| XLogP | 3.14 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |