C20H28O3 — CID 135028415
(4R,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-1,4,6,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one (PubChem CID 135028415) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4R,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-1,4,6,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one.
| Compound Name | (4R,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-1,4,6,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
|---|---|
| PubChem CID | 135028415 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4R,9S,10R,11S,12R)-9-[(E)-but-2-en-2-yl]-1,4,6,10,11-pentamethyl-2,8-dioxatetracyclo[8.2.1.04,12.07,11]tridec-5-en-13-one |
| SMILES | C/C=C(\C)[C@@H]1OC2C(C)=C[C@@]3(C)COC4(C)C(=O)[C@]1(C)[C@]2(C)[C@H]43 |
| InChI | InChI=1S/C20H28O3/c1-8-11(2)13-19(6)16(21)20(7)15-17(4,10-22-20)9-12(3)14(23-13)18(15,19)5/h8-9,13-15H,10H2,1-7H3/b11-8+/t13-,14?,15+,17-,18-,19+,20?/m0/s1 |
| InChIKey | ZWYVVFPRAZRJML-KWWIGPBYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|