C21H36N2O6 — CID 135028875
2-O,8-O-ditert-butyl 4-O-ethyl 2,8-diazaspiro[4.5]decane-2,4,8-tricarboxylate (PubChem CID 135028875) has the molecular formula C21H36N2O6 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-O,8-O-ditert-butyl 4-O-ethyl 2,8-diazaspiro[4.5]decane-2,4,8-tricarboxylate.
| Compound Name | 2-O,8-O-ditert-butyl 4-O-ethyl 2,8-diazaspiro[4.5]decane-2,4,8-tricarboxylate |
|---|---|
| PubChem CID | 135028875 |
| Molecular Formula | C21H36N2O6 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-O,8-O-ditert-butyl 4-O-ethyl 2,8-diazaspiro[4.5]decane-2,4,8-tricarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C21H36N2O6/c1-8-27-16(24)15-13-23(18(26)29-20(5,6)7)14-21(15)9-11-22(12-10-21)17(25)28-19(2,3)4/h15H,8-14H2,1-7H3 |
| InChIKey | OVFXMVIWOWLNHU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|