C42H36O9 — CID 135028939
ethyl 2-[9,14-bis(2-ethoxy-2-oxoethyl)-5,10,15-triphenyl-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaen-4-yl]acetate (PubChem CID 135028939) has the molecular formula C42H36O9 and a molecular weight of 684.74 g/mol. Its IUPAC name is ethyl 2-[9,14-bis(2-ethoxy-2-oxoethyl)-5,10,15-triphenyl-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaen-4-yl]acetate.
| Compound Name | ethyl 2-[9,14-bis(2-ethoxy-2-oxoethyl)-5,10,15-triphenyl-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaen-4-yl]acetate |
|---|---|
| PubChem CID | 135028939 |
| Molecular Formula | C42H36O9 |
| Molecular Weight | 684.74 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | ethyl 2-[9,14-bis(2-ethoxy-2-oxoethyl)-5,10,15-triphenyl-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaen-4-yl]acetate |
| SMILES | CCOC(=O)Cc1oc2c(c1-c1ccccc1)c1oc(CC(=O)OCC)c(-c3ccccc3)c1c1oc(CC(=O)OCC)c(-c3ccccc3)c21 |
| InChI | InChI=1S/C42H36O9/c1-4-46-31(43)22-28-34(25-16-10-7-11-17-25)37-40(49-28)38-35(26-18-12-8-13-19-26)29(23-32(44)47-5-2)51-42(38)39-36(27-20-14-9-15-21-27)30(50-41(37)39)24-33(45)48-6-3/h7-21H,4-6,22-24H2,1-3H3 |
| InChIKey | IAVVJJFOMCRQEC-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 118.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.74 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|