About (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate
(2-chloro-4-pyridinyl) 2,2-dimethylpropanoate (PubChem CID 135029376) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate |
| PubChem CID | 135029376 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO2/c1-10(2,3)9(13)14-7-4-5-12-8(11)6-7/h4-6H,1-3H3 |
| InChIKey | DCFHULYSFIIFGH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate?
The IUPAC name of (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate (CID 135029376) is (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate.
What is the SMILES notation for (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate?
The canonical SMILES for (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate is CC(C)(C)C(=O)Oc1ccnc(Cl)c1.
What is the InChIKey of (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate?
The InChIKey is DCFHULYSFIIFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO2/c1-10(2,3)9(13)14-7-4-5-12-8(11)6-7/h4-6H,1-3H3.
What are the key properties of (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate?
(2-chloro-4-pyridinyl) 2,2-dimethylpropanoate has a molecular weight of 213.66 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-pyridinyl) 2,2-dimethylpropanoate is sourced from PubChem (CID 135029376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).