C29H46FN3O7 — CID 135029418
tert-butyl (2S)-4-fluoro-4-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]pentanoate (PubChem CID 135029418) has the molecular formula C29H46FN3O7 and a molecular weight of 567.70 g/mol. Its IUPAC name is tert-butyl (2S)-4-fluoro-4-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]pentanoate.
| Compound Name | tert-butyl (2S)-4-fluoro-4-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 135029418 |
| Molecular Formula | C29H46FN3O7 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | tert-butyl (2S)-4-fluoro-4-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]pentanoate |
| SMILES | CC(C)(F)C[C@H](NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H46FN3O7/c1-27(2,3)39-24(35)22(18-29(7,8)30)32-23(34)21(33-26(37)40-28(4,5)6)16-12-13-17-31-25(36)38-19-20-14-10-9-11-15-20/h9-11,14-15,21-22H,12-13,16-19H2,1-8H3,(H,31,36)(H,32,34)(H,33,37)/t21-,22-/m0/s1 |
| InChIKey | HDCIFLOGBNODED-VXKWHMMOSA-N |
| XLogP | 4.94 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|