C17H12N2OS — CID 135029537
4-[5-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzonitrile (PubChem CID 135029537) has the molecular formula C17H12N2OS and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-[5-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzonitrile.
| Compound Name | 4-[5-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 135029537 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[5-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ncc(CSc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C17H12N2OS/c18-10-13-6-8-14(9-7-13)17-19-11-15(20-17)12-21-16-4-2-1-3-5-16/h1-9,11H,12H2 |
| InChIKey | NCBMWWRGUYYHPF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |