C14H23NO — CID 135029564
(2E,10Z)-4-hydroxy-4-methyltrideca-2,10-dienenitrile (PubChem CID 135029564) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (2E,10Z)-4-hydroxy-4-methyltrideca-2,10-dienenitrile.
| Compound Name | (2E,10Z)-4-hydroxy-4-methyltrideca-2,10-dienenitrile |
|---|---|
| PubChem CID | 135029564 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2E,10Z)-4-hydroxy-4-methyltrideca-2,10-dienenitrile |
| SMILES | CC/C=C\CCCCCC(C)(O)/C=C/C#N |
| InChI | InChI=1S/C14H23NO/c1-3-4-5-6-7-8-9-11-14(2,16)12-10-13-15/h4-5,10,12,16H,3,6-9,11H2,1-2H3/b5-4-,12-10+ |
| InChIKey | IHBGHYDHOZBKQH-KYTHIUCFSA-N |
| XLogP | 3.73 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|