About ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate
ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 135029723) has the molecular formula C24H19F6NO2
and a molecular weight of 467.41 g/mol. Its IUPAC name is ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate |
| PubChem CID | 135029723 |
| Molecular Formula | C24H19F6NO2 |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(F)(F)F)c(-c2ccccc2C)c(-c2ccccc2C)c1C(F)(F)F |
| InChI | InChI=1S/C24H19F6NO2/c1-4-33-22(32)20-19(23(25,26)27)17(15-11-7-5-9-13(15)2)18(21(31-20)24(28,29)30)16-12-8-6-10-14(16)3/h5-12H,4H2,1-3H3 |
| InChIKey | FASAARYEJTYYBX-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate?
The IUPAC name of ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate (CID 135029723) is ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate.
What is the SMILES notation for ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate?
The canonical SMILES for ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate is CCOC(=O)c1nc(C(F)(F)F)c(-c2ccccc2C)c(-c2ccccc2C)c1C(F)(F)F.
What is the InChIKey of ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate?
The InChIKey is FASAARYEJTYYBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F6NO2/c1-4-33-22(32)20-19(23(25,26)27)17(15-11-7-5-9-13(15)2)18(21(31-20)24(28,29)30)16-12-8-6-10-14(16)3/h5-12H,4H2,1-3H3.
What are the key properties of ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate?
ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate has a molecular weight of 467.41 g/mol, XLogP of 7.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4,5-bis(2-methylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate is sourced from PubChem (CID 135029723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).