About [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate
[4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate (PubChem CID 135029917) has the molecular formula C17H23F3O3S2Si2
and a molecular weight of 452.67 g/mol. Its IUPAC name is [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 135029917 |
| Molecular Formula | C17H23F3O3S2Si2 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1cc(-c2cccs2)cc([Si](C)(C)C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H23F3O3S2Si2/c1-26(2,3)14-10-12(13-8-7-9-24-13)11-15(27(4,5)6)16(14)23-25(21,22)17(18,19)20/h7-11H,1-6H3 |
| InChIKey | MYKUJHUADACXSW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate (CID 135029917) is [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate is C[Si](C)(C)c1cc(-c2cccs2)cc([Si](C)(C)C)c1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate?
The InChIKey is MYKUJHUADACXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F3O3S2Si2/c1-26(2,3)14-10-12(13-8-7-9-24-13)11-15(27(4,5)6)16(14)23-25(21,22)17(18,19)20/h7-11H,1-6H3.
What are the key properties of [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate?
[4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate has a molecular weight of 452.67 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-thiophen-2-yl-2,6-bis(trimethylsilyl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 135029917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).