C20H32O4 — CID 135029965
(1'R,4'aR,8'aR)-1'-[(E)-5-hydroxy-3-methylpent-2-enyl]-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one (PubChem CID 135029965) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1'R,4'aR,8'aR)-1'-[(E)-5-hydroxy-3-methylpent-2-enyl]-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one.
| Compound Name | (1'R,4'aR,8'aR)-1'-[(E)-5-hydroxy-3-methylpent-2-enyl]-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
|---|---|
| PubChem CID | 135029965 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1'R,4'aR,8'aR)-1'-[(E)-5-hydroxy-3-methylpent-2-enyl]-1',4'a-dimethylspiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-2'-one |
| SMILES | C/C(=C\C[C@@]1(C)C(=O)CC[C@]2(C)[C@@H]1CCCC21OCCO1)CCO |
| InChI | InChI=1S/C20H32O4/c1-15(8-12-21)6-10-18(2)16-5-4-9-20(23-13-14-24-20)19(16,3)11-7-17(18)22/h6,16,21H,4-5,7-14H2,1-3H3/b15-6+/t16-,18-,19-/m1/s1 |
| InChIKey | BFSGRAWXGYILKJ-ZZQZADDVSA-N |
| XLogP | 3.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|