C21H34O3 — CID 135030185
(E)-5-[(1'R,4'aR,8'aR)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-yl]-3-methylpent-3-en-1-ol (PubChem CID 135030185) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (E)-5-[(1'R,4'aR,8'aR)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-yl]-3-methylpent-3-en-1-ol.
| Compound Name | (E)-5-[(1'R,4'aR,8'aR)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-yl]-3-methylpent-3-en-1-ol |
|---|---|
| PubChem CID | 135030185 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (E)-5-[(1'R,4'aR,8'aR)-1',4'a-dimethyl-2'-methylidenespiro[1,3-dioxolane-2,5'-3,4,6,7,8,8a-hexahydronaphthalene]-1'-yl]-3-methylpent-3-en-1-ol |
| SMILES | C=C1CC[C@]2(C)[C@H](CCCC23OCCO3)[C@@]1(C)C/C=C(\C)CCO |
| InChI | InChI=1S/C21H34O3/c1-16(9-13-22)7-11-19(3)17(2)8-12-20(4)18(19)6-5-10-21(20)23-14-15-24-21/h7,18,22H,2,5-6,8-15H2,1,3-4H3/b16-7+/t18-,19+,20-/m1/s1 |
| InChIKey | PZULHIQINBURRK-HMGSCMIVSA-N |
| XLogP | 4.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|