C44H50O6 — CID 135030345
(2S,5R)-2-(1-adamantyloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 135030345) has the molecular formula C44H50O6 and a molecular weight of 674.88 g/mol. Its IUPAC name is (2S,5R)-2-(1-adamantyloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,5R)-2-(1-adamantyloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 135030345 |
| Molecular Formula | C44H50O6 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | (2S,5R)-2-(1-adamantyloxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | c1ccc(COCC2O[C@@H](OC34CC5CC(CC(C5)C3)C4)C(OCc3ccccc3)C(OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C44H50O6/c1-5-13-32(14-6-1)27-45-31-39-40(46-28-33-15-7-2-8-16-33)41(47-29-34-17-9-3-10-18-34)42(48-30-35-19-11-4-12-20-35)43(49-39)50-44-24-36-21-37(25-44)23-38(22-36)26-44/h1-20,36-43H,21-31H2/t36?,37?,38?,39?,40-,41?,42?,43+,44?/m1/s1 |
| InChIKey | ARSXFHWAVPYIDC-ZISXHYCYSA-N |
| XLogP | 8.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |