C22H16N2O6 — CID 135030374
2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)hexa-2,4-diynyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 135030374) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)hexa-2,4-diynyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)hexa-2,4-diynyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 135030374 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[6-(1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl)hexa-2,4-diynyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1C2C3C=CC(O3)C2C(=O)N1CC#CC#CCN1C(=O)C2C3C=CC(O3)C2C1=O |
| InChI | InChI=1S/C22H16N2O6/c25-19-15-11-5-6-12(29-11)16(15)20(26)23(19)9-3-1-2-4-10-24-21(27)17-13-7-8-14(30-13)18(17)22(24)28/h5-8,11-18H,9-10H2 |
| InChIKey | HHONZPQUIRWOFN-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|