C23H34N2O2S — CID 135030424
1-(2,2-dimethylpropanoyl)-N-pentylspiro[2H-indole-3,4'-thiane]-2-carboxamide (PubChem CID 135030424) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-pentylspiro[2H-indole-3,4'-thiane]-2-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-pentylspiro[2H-indole-3,4'-thiane]-2-carboxamide |
|---|---|
| PubChem CID | 135030424 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-pentylspiro[2H-indole-3,4'-thiane]-2-carboxamide |
| SMILES | CCCCCNC(=O)C1N(C(=O)C(C)(C)C)c2ccccc2C12CCSCC2 |
| InChI | InChI=1S/C23H34N2O2S/c1-5-6-9-14-24-20(26)19-23(12-15-28-16-13-23)17-10-7-8-11-18(17)25(19)21(27)22(2,3)4/h7-8,10-11,19H,5-6,9,12-16H2,1-4H3,(H,24,26) |
| InChIKey | YJMZFBXWUVJRER-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|