C23H26O6 — CID 135030803
4,5,6,7-tetramethoxy-3,8,8,9-tetramethyl-9H-phenaleno[1,2-b]furan-1-one (PubChem CID 135030803) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4,5,6,7-tetramethoxy-3,8,8,9-tetramethyl-9H-phenaleno[1,2-b]furan-1-one.
| Compound Name | 4,5,6,7-tetramethoxy-3,8,8,9-tetramethyl-9H-phenaleno[1,2-b]furan-1-one |
|---|---|
| PubChem CID | 135030803 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4,5,6,7-tetramethoxy-3,8,8,9-tetramethyl-9H-phenaleno[1,2-b]furan-1-one |
| SMILES | COc1c(OC)c2c3c(c4c(c(OC)c3c1OC)C(C)(C)C(C)O4)C(=O)C=C2C |
| InChI | InChI=1S/C23H26O6/c1-10-9-12(24)14-15-13(10)20(26-6)22(28-8)21(27-7)16(15)18(25-5)17-19(14)29-11(2)23(17,3)4/h9,11H,1-8H3 |
| InChIKey | VXUCSLIKVWTANH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |