About methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate
methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate (PubChem CID 135031390) has the molecular formula C16H15F5O3S
and a molecular weight of 382.35 g/mol. Its IUPAC name is methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate |
| PubChem CID | 135031390 |
| Molecular Formula | C16H15F5O3S |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](c1ccc(S(F)(F)(F)(F)F)cc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H15F5O3S/c1-24-16(23)14(15(22)12-5-3-2-4-6-12)11-7-9-13(10-8-11)25(17,18,19,20)21/h2-10,14-15,22H,1H3/t14-,15-/m1/s1 |
| InChIKey | POXAXLDLHIWAHI-HUUCEWRRSA-N |
| XLogP | 5.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate?
The IUPAC name of methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate (CID 135031390) is methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate.
What is the SMILES notation for methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate?
The canonical SMILES for methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate is COC(=O)[C@H](c1ccc(S(F)(F)(F)(F)F)cc1)[C@H](O)c1ccccc1.
What is the InChIKey of methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate?
The InChIKey is POXAXLDLHIWAHI-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H15F5O3S/c1-24-16(23)14(15(22)12-5-3-2-4-6-12)11-7-9-13(10-8-11)25(17,18,19,20)21/h2-10,14-15,22H,1H3/t14-,15-/m1/s1.
What are the key properties of methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate?
methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate has a molecular weight of 382.35 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3S)-3-hydroxy-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate is sourced from PubChem (CID 135031390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).