C14H24Si — CID 135031444
[(3aE,6Z)-2,3,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-4-yl]-trimethylsilane (PubChem CID 135031444) has the molecular formula C14H24Si and a molecular weight of 220.43 g/mol. Its IUPAC name is [(3aE,6Z)-2,3,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-4-yl]-trimethylsilane.
| Compound Name | [(3aE,6Z)-2,3,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 135031444 |
| Molecular Formula | C14H24Si |
| Molecular Weight | 220.43 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [(3aE,6Z)-2,3,5,8,9,9a-hexahydro-1H-cyclopenta[8]annulen-4-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C1=C2\CCCC2CC/C=C\C1 |
| InChI | InChI=1S/C14H24Si/c1-15(2,3)14-11-6-4-5-8-12-9-7-10-13(12)14/h4,6,12H,5,7-11H2,1-3H3/b6-4-,14-13+ |
| InChIKey | VBEBVJYJXIMCDT-DTGWBGTFSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|