C21H29BrN2 — CID 135031651
(8bS)-6-bromo-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 135031651) has the molecular formula C21H29BrN2 and a molecular weight of 389.38 g/mol. Its IUPAC name is (8bS)-6-bromo-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | (8bS)-6-bromo-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 135031651 |
| Molecular Formula | C21H29BrN2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (8bS)-6-bromo-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | CC(C)=CCN1c2cc(Br)ccc2[C@]2(CC=C(C)C)CCN(C)C12 |
| InChI | InChI=1S/C21H29BrN2/c1-15(2)8-10-21-11-13-23(5)20(21)24(12-9-16(3)4)19-14-17(22)6-7-18(19)21/h6-9,14,20H,10-13H2,1-5H3/t20?,21-/m0/s1 |
| InChIKey | AXCACHVTDPCEAS-LBAQZLPGSA-N |
| XLogP | 5.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|