About butylamino(cyclopenta-2,4-dien-1-ylidene)methanol
butylamino(cyclopenta-2,4-dien-1-ylidene)methanol (PubChem CID 135031705) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is butylamino(cyclopenta-2,4-dien-1-ylidene)methanol.
Molecular Properties
| Compound Name | butylamino(cyclopenta-2,4-dien-1-ylidene)methanol |
| PubChem CID | 135031705 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | butylamino(cyclopenta-2,4-dien-1-ylidene)methanol |
| SMILES | CCCCNC(O)=C1C=CC=C1 |
| InChI | InChI=1S/C10H15NO/c1-2-3-8-11-10(12)9-6-4-5-7-9/h4-7,11-12H,2-3,8H2,1H3 |
| InChIKey | VHPJRPPSSGIZBL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butylamino(cyclopenta-2,4-dien-1-ylidene)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylamino(cyclopenta-2,4-dien-1-ylidene)methanol?
The IUPAC name of butylamino(cyclopenta-2,4-dien-1-ylidene)methanol (CID 135031705) is butylamino(cyclopenta-2,4-dien-1-ylidene)methanol.
What is the SMILES notation for butylamino(cyclopenta-2,4-dien-1-ylidene)methanol?
The canonical SMILES for butylamino(cyclopenta-2,4-dien-1-ylidene)methanol is CCCCNC(O)=C1C=CC=C1.
What is the InChIKey of butylamino(cyclopenta-2,4-dien-1-ylidene)methanol?
The InChIKey is VHPJRPPSSGIZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-2-3-8-11-10(12)9-6-4-5-7-9/h4-7,11-12H,2-3,8H2,1H3.
What are the key properties of butylamino(cyclopenta-2,4-dien-1-ylidene)methanol?
butylamino(cyclopenta-2,4-dien-1-ylidene)methanol has a molecular weight of 165.24 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylamino(cyclopenta-2,4-dien-1-ylidene)methanol is sourced from PubChem (CID 135031705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).