C21H19NO7 — CID 135031743
2-O-benzyl 4-O,5-O-dimethyl 3-phenyl-3H-1,2-oxazole-2,4,5-tricarboxylate (PubChem CID 135031743) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-O-benzyl 4-O,5-O-dimethyl 3-phenyl-3H-1,2-oxazole-2,4,5-tricarboxylate.
| Compound Name | 2-O-benzyl 4-O,5-O-dimethyl 3-phenyl-3H-1,2-oxazole-2,4,5-tricarboxylate |
|---|---|
| PubChem CID | 135031743 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-O-benzyl 4-O,5-O-dimethyl 3-phenyl-3H-1,2-oxazole-2,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccccc2)N(C(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C21H19NO7/c1-26-19(23)16-17(15-11-7-4-8-12-15)22(29-18(16)20(24)27-2)21(25)28-13-14-9-5-3-6-10-14/h3-12,17H,13H2,1-2H3 |
| InChIKey | ZSGVJIKGDGTUDG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|