C18H34O4Si — CID 135031902
[(E)-3-[(1S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylcyclopropyl]prop-2-enyl] ethyl carbonate (PubChem CID 135031902) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is [(E)-3-[(1S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylcyclopropyl]prop-2-enyl] ethyl carbonate.
| Compound Name | [(E)-3-[(1S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylcyclopropyl]prop-2-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 135031902 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(E)-3-[(1S,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethylcyclopropyl]prop-2-enyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C/[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-9-20-16(19)21-12-10-11-14-15(18(14,5)6)13-22-23(7,8)17(2,3)4/h10-11,14-15H,9,12-13H2,1-8H3/b11-10+/t14-,15+/m0/s1 |
| InChIKey | ZVSRDCRZXZGOAW-KZGTWKPJSA-N |
| XLogP | 5.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|