About 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine
1-hydroxy-2,2,6-trimethyl-6-methylpiperidine (PubChem CID 135031969) has the molecular formula C9H18NO+
and a molecular weight of 156.25 g/mol. Its IUPAC name is 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine.
Molecular Properties
| Compound Name | 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine |
| PubChem CID | 135031969 |
| Molecular Formula | C9H18NO+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine |
| SMILES | [CH2+]C1(C)CCCC(C)(C)N1O |
| InChI | InChI=1S/C9H18NO/c1-8(2)6-5-7-9(3,4)10(8)11/h11H,1,5-7H2,2-4H3/q+1 |
| InChIKey | UMGNXWQBEIYSLU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine?
The IUPAC name of 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine (CID 135031969) is 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine.
What is the SMILES notation for 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine?
The canonical SMILES for 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine is [CH2+]C1(C)CCCC(C)(C)N1O.
What is the InChIKey of 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine?
The InChIKey is UMGNXWQBEIYSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO/c1-8(2)6-5-7-9(3,4)10(8)11/h11H,1,5-7H2,2-4H3/q+1.
What are the key properties of 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine?
1-hydroxy-2,2,6-trimethyl-6-methylpiperidine has a molecular weight of 156.25 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,2,6-trimethyl-6-methylpiperidine is sourced from PubChem (CID 135031969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).