C22H26N2O2 — CID 135032092
(6R,7R,11R)-16-methoxy-10-(2-methoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene (PubChem CID 135032092) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (6R,7R,11R)-16-methoxy-10-(2-methoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene.
| Compound Name | (6R,7R,11R)-16-methoxy-10-(2-methoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene |
|---|---|
| PubChem CID | 135032092 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (6R,7R,11R)-16-methoxy-10-(2-methoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene |
| SMILES | COc1ccccc1N1CC[C@@H]2[C@H]3CCCN3c3c(OC)cccc3[C@@H]21 |
| InChI | InChI=1S/C22H26N2O2/c1-25-19-10-4-3-8-18(19)24-14-12-15-17-9-6-13-23(17)22-16(21(15)24)7-5-11-20(22)26-2/h3-5,7-8,10-11,15,17,21H,6,9,12-14H2,1-2H3/t15-,17-,21-/m1/s1 |
| InChIKey | WRDWHCUSCFHCPK-QLVMHMETSA-N |
| XLogP | 4.25 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |