C30H32N2P2 — CID 135032203
13,17-diphenyl-2,6-diaza-13,17-diphosphatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene (PubChem CID 135032203) has the molecular formula C30H32N2P2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 13,17-diphenyl-2,6-diaza-13,17-diphosphatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene.
| Compound Name | 13,17-diphenyl-2,6-diaza-13,17-diphosphatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene |
|---|---|
| PubChem CID | 135032203 |
| Molecular Formula | C30H32N2P2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 13,17-diphenyl-2,6-diaza-13,17-diphosphatricyclo[16.4.0.07,12]docosa-1(22),7,9,11,18,20-hexaene |
| SMILES | c1ccc([P@@]2CCC[P@@](c3ccccc3)c3ccccc3NCCCNc3ccccc32)cc1 |
| InChI | InChI=1S/C30H32N2P2/c1-3-13-25(14-4-1)33-23-12-24-34(26-15-5-2-6-16-26)30-20-10-8-18-28(30)32-22-11-21-31-27-17-7-9-19-29(27)33/h1-10,13-20,31-32H,11-12,21-24H2/t33-,34+ |
| InChIKey | UBJNRKNRQMCUEA-AQOUDTPCSA-N |
| XLogP | 5.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|