About 5-nitropent-1-en-3-yl acetate
5-nitropent-1-en-3-yl acetate (PubChem CID 135032234) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is 5-nitropent-1-en-3-yl acetate.
Molecular Properties
| Compound Name | 5-nitropent-1-en-3-yl acetate |
| PubChem CID | 135032234 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 5-nitropent-1-en-3-yl acetate |
| SMILES | C=CC(CC[N+](=O)[O-])OC(C)=O |
| InChI | InChI=1S/C7H11NO4/c1-3-7(12-6(2)9)4-5-8(10)11/h3,7H,1,4-5H2,2H3 |
| InChIKey | MFYVUJFWSGCRCM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitropent-1-en-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitropent-1-en-3-yl acetate?
The IUPAC name of 5-nitropent-1-en-3-yl acetate (CID 135032234) is 5-nitropent-1-en-3-yl acetate.
What is the SMILES notation for 5-nitropent-1-en-3-yl acetate?
The canonical SMILES for 5-nitropent-1-en-3-yl acetate is C=CC(CC[N+](=O)[O-])OC(C)=O.
What is the InChIKey of 5-nitropent-1-en-3-yl acetate?
The InChIKey is MFYVUJFWSGCRCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c1-3-7(12-6(2)9)4-5-8(10)11/h3,7H,1,4-5H2,2H3.
What are the key properties of 5-nitropent-1-en-3-yl acetate?
5-nitropent-1-en-3-yl acetate has a molecular weight of 173.17 g/mol, XLogP of 0.77, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitropent-1-en-3-yl acetate is sourced from PubChem (CID 135032234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).