C12H20O2 — CID 135032763
2-[(E)-3-cyclohexylprop-2-enyl]-1,3-dioxolane (PubChem CID 135032763) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-[(E)-3-cyclohexylprop-2-enyl]-1,3-dioxolane.
| Compound Name | 2-[(E)-3-cyclohexylprop-2-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 135032763 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-[(E)-3-cyclohexylprop-2-enyl]-1,3-dioxolane |
| SMILES | C(=C/C1CCCCC1)\CC1OCCO1 |
| InChI | InChI=1S/C12H20O2/c1-2-5-11(6-3-1)7-4-8-12-13-9-10-14-12/h4,7,11-12H,1-3,5-6,8-10H2/b7-4+ |
| InChIKey | DSNBGQRJMHONAP-QPJJXVBHSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|