C43H51NO11S — CID 135032920
[(3R,4S,6S)-6-[(2S,3S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyl-4-[(4-methylphenyl)sulfonylamino]oxan-3-yl] acetate (PubChem CID 135032920) has the molecular formula C43H51NO11S and a molecular weight of 789.94 g/mol. Its IUPAC name is [(3R,4S,6S)-6-[(2S,3S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyl-4-[(4-methylphenyl)sulfonylamino]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,6S)-6-[(2S,3S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyl-4-[(4-methylphenyl)sulfonylamino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 135032920 |
| Molecular Formula | C43H51NO11S |
| Molecular Weight | 789.94 g/mol |
| Exact Mass | 789.32 |
| IUPAC Name | [(3R,4S,6S)-6-[(2S,3S,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyl-4-[(4-methylphenyl)sulfonylamino]oxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@@H](COCc2ccccc2)[C@H](O[C@H]2C[C@H](NS(=O)(=O)c3ccc(C)cc3)[C@@H](OC(C)=O)C(C)O2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C43H51NO11S/c1-29-20-22-35(23-21-29)56(46,47)44-36-24-38(52-30(2)39(36)53-31(3)45)55-40-37(28-49-25-32-14-8-5-9-15-32)54-43(48-4)42(51-27-34-18-12-7-13-19-34)41(40)50-26-33-16-10-6-11-17-33/h5-23,30,36-44H,24-28H2,1-4H3/t30?,36-,37-,38-,39-,40-,41?,42?,43-/m0/s1 |
| InChIKey | SGYIRGMLKLWKFD-ASVKOCOHSA-N |
| XLogP | 5.85 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.94 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |