About [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate
[(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate (PubChem CID 135032976) has the molecular formula C15H20O9
and a molecular weight of 344.32 g/mol. Its IUPAC name is [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate |
| PubChem CID | 135032976 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate |
| SMILES | C=C1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H20O9/c1-7-13(22-9(3)17)15(24-11(5)19)14(23-10(4)18)12(21-7)6-20-8(2)16/h12-15H,1,6H2,2-5H3/t12?,13?,14-,15?/m1/s1 |
| InChIKey | WOTRYDYQXHDHQN-MIGSVPMKSA-N |
| XLogP | 0.26 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate?
The IUPAC name of [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate (CID 135032976) is [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate.
What is the SMILES notation for [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate?
The canonical SMILES for [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate is C=C1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate?
The InChIKey is WOTRYDYQXHDHQN-MIGSVPMKSA-N. The full InChI is InChI=1S/C15H20O9/c1-7-13(22-9(3)17)15(24-11(5)19)14(23-10(4)18)12(21-7)6-20-8(2)16/h12-15H,1,6H2,2-5H3/t12?,13?,14-,15?/m1/s1.
What are the key properties of [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate?
[(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate has a molecular weight of 344.32 g/mol, XLogP of 0.26, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3,4,5-triacetyloxy-6-methylideneoxan-2-yl]methyl acetate is sourced from PubChem (CID 135032976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).