C11H22N2 — CID 135032990
(2S,5R)-2-but-3-enyl-N,N,5-trimethylpyrrolidin-1-amine (PubChem CID 135032990) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (2S,5R)-2-but-3-enyl-N,N,5-trimethylpyrrolidin-1-amine.
| Compound Name | (2S,5R)-2-but-3-enyl-N,N,5-trimethylpyrrolidin-1-amine |
|---|---|
| PubChem CID | 135032990 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (2S,5R)-2-but-3-enyl-N,N,5-trimethylpyrrolidin-1-amine |
| SMILES | C=CCC[C@H]1CC[C@@H](C)N1N(C)C |
| InChI | InChI=1S/C11H22N2/c1-5-6-7-11-9-8-10(2)13(11)12(3)4/h5,10-11H,1,6-9H2,2-4H3/t10-,11+/m1/s1 |
| InChIKey | PINIQWGQSNFWIX-MNOVXSKESA-N |
| XLogP | 2.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|