C22H24O3S — CID 135033188
(3aS,5aR,8S,9aR)-8-hydroxy-3a,5a,6-trimethyl-1-phenylsulfanyl-4,8,9,9a-tetrahydro-3H-cyclopenta[a]naphthalene-2,5-dione (PubChem CID 135033188) has the molecular formula C22H24O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is (3aS,5aR,8S,9aR)-8-hydroxy-3a,5a,6-trimethyl-1-phenylsulfanyl-4,8,9,9a-tetrahydro-3H-cyclopenta[a]naphthalene-2,5-dione.
| Compound Name | (3aS,5aR,8S,9aR)-8-hydroxy-3a,5a,6-trimethyl-1-phenylsulfanyl-4,8,9,9a-tetrahydro-3H-cyclopenta[a]naphthalene-2,5-dione |
|---|---|
| PubChem CID | 135033188 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (3aS,5aR,8S,9aR)-8-hydroxy-3a,5a,6-trimethyl-1-phenylsulfanyl-4,8,9,9a-tetrahydro-3H-cyclopenta[a]naphthalene-2,5-dione |
| SMILES | CC1=C[C@@H](O)C[C@H]2C3=C(Sc4ccccc4)C(=O)C[C@]3(C)CC(=O)[C@@]12C |
| InChI | InChI=1S/C22H24O3S/c1-13-9-14(23)10-16-19-20(26-15-7-5-4-6-8-15)17(24)11-21(19,2)12-18(25)22(13,16)3/h4-9,14,16,23H,10-12H2,1-3H3/t14-,16+,21-,22+/m1/s1 |
| InChIKey | CDJYSXLGMUGCAS-FVMLFMEYSA-N |
| XLogP | 4.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|