C22H26O4S — CID 135033242
(3S,4aR,6S,8aR)-6-hydroxy-3,8,8a-trimethyl-3-(2-oxo-3-phenylsulfanylpropyl)-2,4a,5,6-tetrahydronaphthalene-1,4-dione (PubChem CID 135033242) has the molecular formula C22H26O4S and a molecular weight of 386.51 g/mol. Its IUPAC name is (3S,4aR,6S,8aR)-6-hydroxy-3,8,8a-trimethyl-3-(2-oxo-3-phenylsulfanylpropyl)-2,4a,5,6-tetrahydronaphthalene-1,4-dione.
| Compound Name | (3S,4aR,6S,8aR)-6-hydroxy-3,8,8a-trimethyl-3-(2-oxo-3-phenylsulfanylpropyl)-2,4a,5,6-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 135033242 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (3S,4aR,6S,8aR)-6-hydroxy-3,8,8a-trimethyl-3-(2-oxo-3-phenylsulfanylpropyl)-2,4a,5,6-tetrahydronaphthalene-1,4-dione |
| SMILES | CC1=C[C@@H](O)C[C@H]2C(=O)[C@](C)(CC(=O)CSc3ccccc3)CC(=O)[C@@]12C |
| InChI | InChI=1S/C22H26O4S/c1-14-9-15(23)10-18-20(26)21(2,12-19(25)22(14,18)3)11-16(24)13-27-17-7-5-4-6-8-17/h4-9,15,18,23H,10-13H2,1-3H3/t15-,18+,21-,22+/m1/s1 |
| InChIKey | FCZGTEXORXLYTG-AOWNQLHBSA-N |
| XLogP | 3.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|