About O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate
O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate (PubChem CID 135033267) has the molecular formula C14H24O4S3
and a molecular weight of 352.54 g/mol. Its IUPAC name is O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate |
| PubChem CID | 135033267 |
| Molecular Formula | C14H24O4S3 |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CC1CCSC1=O)C(OCC)OCC |
| InChI | InChI=1S/C14H24O4S3/c1-4-16-13(17-5-2)11(21-14(19)18-6-3)9-10-7-8-20-12(10)15/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | JOPOAEGPAMKBPV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate?
The IUPAC name of O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate (CID 135033267) is O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate.
What is the SMILES notation for O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate?
The canonical SMILES for O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate is CCOC(=S)SC(CC1CCSC1=O)C(OCC)OCC.
What is the InChIKey of O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate?
The InChIKey is JOPOAEGPAMKBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4S3/c1-4-16-13(17-5-2)11(21-14(19)18-6-3)9-10-7-8-20-12(10)15/h10-11,13H,4-9H2,1-3H3.
What are the key properties of O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate?
O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate has a molecular weight of 352.54 g/mol, XLogP of 3.48, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl [1,1-diethoxy-3-(2-oxothiolan-3-yl)propan-2-yl]sulfanylmethanethioate is sourced from PubChem (CID 135033267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).