C29H30O4 — CID 135033592
tert-butyl (1R,2R,6R,7R)-5-benzhydrylidene-7-methyl-10-oxo-11-oxatricyclo[5.3.1.02,6]undec-3-ene-1-carboxylate (PubChem CID 135033592) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is tert-butyl (1R,2R,6R,7R)-5-benzhydrylidene-7-methyl-10-oxo-11-oxatricyclo[5.3.1.02,6]undec-3-ene-1-carboxylate.
| Compound Name | tert-butyl (1R,2R,6R,7R)-5-benzhydrylidene-7-methyl-10-oxo-11-oxatricyclo[5.3.1.02,6]undec-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 135033592 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | tert-butyl (1R,2R,6R,7R)-5-benzhydrylidene-7-methyl-10-oxo-11-oxatricyclo[5.3.1.02,6]undec-3-ene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]12O[C@](C)(CCC1=O)[C@H]1C(=C(c3ccccc3)c3ccccc3)C=C[C@H]12 |
| InChI | InChI=1S/C29H30O4/c1-27(2,3)32-26(31)29-22-16-15-21(25(22)28(4,33-29)18-17-23(29)30)24(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-16,22,25H,17-18H2,1-4H3/t22-,25+,28-,29-/m1/s1 |
| InChIKey | IMMXQVJVGRTFNI-NUVJPRFLSA-N |
| XLogP | 5.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|