C28H38N4O8 — CID 135033700
[(1R,2S,3S,4R,5R)-5-(3-acetylanilino)-4-amino-3-(dimethylcarbamoylamino)-1,2-dihydroxy-3-[(1R)-1-hydroxyethyl]-2-methylcyclopentyl]methyl 2-hydroxy-6-methylbenzoate (PubChem CID 135033700) has the molecular formula C28H38N4O8 and a molecular weight of 558.63 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5R)-5-(3-acetylanilino)-4-amino-3-(dimethylcarbamoylamino)-1,2-dihydroxy-3-[(1R)-1-hydroxyethyl]-2-methylcyclopentyl]methyl 2-hydroxy-6-methylbenzoate.
| Compound Name | [(1R,2S,3S,4R,5R)-5-(3-acetylanilino)-4-amino-3-(dimethylcarbamoylamino)-1,2-dihydroxy-3-[(1R)-1-hydroxyethyl]-2-methylcyclopentyl]methyl 2-hydroxy-6-methylbenzoate |
|---|---|
| PubChem CID | 135033700 |
| Molecular Formula | C28H38N4O8 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | [(1R,2S,3S,4R,5R)-5-(3-acetylanilino)-4-amino-3-(dimethylcarbamoylamino)-1,2-dihydroxy-3-[(1R)-1-hydroxyethyl]-2-methylcyclopentyl]methyl 2-hydroxy-6-methylbenzoate |
| SMILES | CC(=O)c1cccc(N[C@@H]2[C@@H](N)[C@](NC(=O)N(C)C)([C@@H](C)O)[C@](C)(O)[C@]2(O)COC(=O)c2c(C)cccc2O)c1 |
| InChI | InChI=1S/C28H38N4O8/c1-15-9-7-12-20(35)21(15)24(36)40-14-27(39)23(30-19-11-8-10-18(13-19)16(2)33)22(29)28(17(3)34,26(27,4)38)31-25(37)32(5)6/h7-13,17,22-23,30,34-35,38-39H,14,29H2,1-6H3,(H,31,37)/t17-,22-,23-,26-,27+,28-/m1/s1 |
| InChIKey | WVIUOSJLUCTGFK-KEKISCNQSA-N |
| XLogP | 0.75 |
| TPSA | 194.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |