C16H32N2O — CID 135033803
(2S,4S)-4-methyl-1,5-bis[(2S)-piperidin-2-yl]pentan-2-ol (PubChem CID 135033803) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is (2S,4S)-4-methyl-1,5-bis[(2S)-piperidin-2-yl]pentan-2-ol.
| Compound Name | (2S,4S)-4-methyl-1,5-bis[(2S)-piperidin-2-yl]pentan-2-ol |
|---|---|
| PubChem CID | 135033803 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | (2S,4S)-4-methyl-1,5-bis[(2S)-piperidin-2-yl]pentan-2-ol |
| SMILES | C[C@H](C[C@H](O)C[C@@H]1CCCCN1)C[C@@H]1CCCCN1 |
| InChI | InChI=1S/C16H32N2O/c1-13(10-14-6-2-4-8-17-14)11-16(19)12-15-7-3-5-9-18-15/h13-19H,2-12H2,1H3/t13-,14-,15-,16-/m0/s1 |
| InChIKey | DIEGHGNTYXOAHK-VGWMRTNUSA-N |
| XLogP | 2.44 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |