C22H22N4Si2 — CID 135034049
3-[2-[(2,3-dicyanophenyl)-dimethylsilyl]ethyl-dimethylsilyl]benzene-1,2-dicarbonitrile (PubChem CID 135034049) has the molecular formula C22H22N4Si2 and a molecular weight of 398.62 g/mol. Its IUPAC name is 3-[2-[(2,3-dicyanophenyl)-dimethylsilyl]ethyl-dimethylsilyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-[(2,3-dicyanophenyl)-dimethylsilyl]ethyl-dimethylsilyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135034049 |
| Molecular Formula | C22H22N4Si2 |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[2-[(2,3-dicyanophenyl)-dimethylsilyl]ethyl-dimethylsilyl]benzene-1,2-dicarbonitrile |
| SMILES | C[Si](C)(CC[Si](C)(C)c1cccc(C#N)c1C#N)c1cccc(C#N)c1C#N |
| InChI | InChI=1S/C22H22N4Si2/c1-27(2,21-9-5-7-17(13-23)19(21)15-25)11-12-28(3,4)22-10-6-8-18(14-24)20(22)16-26/h5-10H,11-12H2,1-4H3 |
| InChIKey | ZQVFLGMMTJMKHK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|