C17H13F3N2O — CID 135034057
1-benzyl-3-(2,2,2-trifluoroethylimino)indol-2-one (PubChem CID 135034057) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 1-benzyl-3-(2,2,2-trifluoroethylimino)indol-2-one.
| Compound Name | 1-benzyl-3-(2,2,2-trifluoroethylimino)indol-2-one |
|---|---|
| PubChem CID | 135034057 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-benzyl-3-(2,2,2-trifluoroethylimino)indol-2-one |
| SMILES | O=C1/C(=N/CC(F)(F)F)c2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C17H13F3N2O/c18-17(19,20)11-21-15-13-8-4-5-9-14(13)22(16(15)23)10-12-6-2-1-3-7-12/h1-9H,10-11H2/b21-15+ |
| InChIKey | ZLVBDEOINCJRRV-RCCKNPSSSA-N |
| XLogP | 3.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|