About 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one
5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one (PubChem CID 135034180) has the molecular formula C26H33NO4S
and a molecular weight of 455.62 g/mol. Its IUPAC name is 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one |
| PubChem CID | 135034180 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one |
| SMILES | CCCCCCC1C(=O)N(S(=O)(=O)c2ccc(C)cc2)CC=C1COCc1ccccc1 |
| InChI | InChI=1S/C26H33NO4S/c1-3-4-5-9-12-25-23(20-31-19-22-10-7-6-8-11-22)17-18-27(26(25)28)32(29,30)24-15-13-21(2)14-16-24/h6-8,10-11,13-17,25H,3-5,9,12,18-20H2,1-2H3 |
| InChIKey | KMWSSURGFIPCLH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one?
The IUPAC name of 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one (CID 135034180) is 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one.
What is the SMILES notation for 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one?
The canonical SMILES for 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one is CCCCCCC1C(=O)N(S(=O)(=O)c2ccc(C)cc2)CC=C1COCc1ccccc1.
What is the InChIKey of 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one?
The InChIKey is KMWSSURGFIPCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H33NO4S/c1-3-4-5-9-12-25-23(20-31-19-22-10-7-6-8-11-22)17-18-27(26(25)28)32(29,30)24-15-13-21(2)14-16-24/h6-8,10-11,13-17,25H,3-5,9,12,18-20H2,1-2H3.
What are the key properties of 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one?
5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one has a molecular weight of 455.62 g/mol, XLogP of 5.26, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-1-(4-methylphenyl)sulfonyl-4-(phenylmethoxymethyl)-2,5-dihydropyridin-6-one is sourced from PubChem (CID 135034180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).