About CID 135034206
CID 135034206 (PubChem CID 135034206) has the molecular formula C33H30F3N3O6
and a molecular weight of 621.61 g/mol.
Molecular Properties
| Compound Name | CID 135034206 |
| PubChem CID | 135034206 |
| Molecular Formula | C33H30F3N3O6 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H]1[C@H](C(F)(F)F)N[C@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C33H30F3N3O6/c1-30(2,3)45-29(43)39-23-17-11-8-14-20(23)31(27(39)41)24(26(40)44-4)25(33(34,35)36)37-32(31)21-15-9-10-16-22(21)38(28(32)42)18-19-12-6-5-7-13-19/h5-17,24-25,37H,18H2,1-4H3/t24-,25-,31+,32-/m1/s1 |
| InChIKey | YFCLOBDSZZVYKK-VGTXAZHUSA-N |
| XLogP | 4.97 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 135034206 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135034206?
The IUPAC name of CID 135034206 (CID 135034206) is not available.
What is the SMILES notation for CID 135034206?
The canonical SMILES for CID 135034206 is COC(=O)[C@H]1[C@H](C(F)(F)F)N[C@]2(C(=O)N(Cc3ccccc3)c3ccccc32)[C@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12.
What is the InChIKey of CID 135034206?
The InChIKey is YFCLOBDSZZVYKK-VGTXAZHUSA-N. The full InChI is InChI=1S/C33H30F3N3O6/c1-30(2,3)45-29(43)39-23-17-11-8-14-20(23)31(27(39)41)24(26(40)44-4)25(33(34,35)36)37-32(31)21-15-9-10-16-22(21)38(28(32)42)18-19-12-6-5-7-13-19/h5-17,24-25,37H,18H2,1-4H3/t24-,25-,31+,32-/m1/s1.
What are the key properties of CID 135034206?
CID 135034206 has a molecular weight of 621.61 g/mol, XLogP of 4.97, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135034206 is sourced from PubChem (CID 135034206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).